CAS 108895-42-7
:2',3'-dideoxy-3'-O-methylthymidine
Description:
2',3'-Dideoxy-3'-O-methylthymidine, also known by its CAS number 108895-42-7, is a nucleoside analog that is structurally related to thymidine. This compound features a modified sugar moiety, specifically lacking the hydroxyl group at the 2' and 3' positions, which contributes to its dideoxy classification. The presence of a methoxy group at the 3' position enhances its stability and influences its biological activity. As a nucleoside analog, it can interfere with nucleic acid synthesis, making it of interest in antiviral and anticancer research. Its mechanism of action typically involves incorporation into DNA, leading to chain termination during replication. The compound is generally characterized by its solubility in organic solvents and limited solubility in water, which can affect its bioavailability. Additionally, its pharmacological properties and potential therapeutic applications are subjects of ongoing research, particularly in the context of viral infections and cancer treatment. Overall, 2',3'-dideoxy-3'-O-methylthymidine represents a significant compound in medicinal chemistry and drug development.
Formula:C11H16N2O5
InChI:InChI=1/C11H16N2O5/c1-6-4-13(11(16)12-10(6)15)9-3-7(17-2)8(5-14)18-9/h4,7-9,14H,3,5H2,1-2H3,(H,12,15,16)/t7-,8+,9+/m0/s1
Synonyms:- 3'-O-Methylthymidine
- Nsc 665482
- Omet
- Thymidine, 3'-O-methyl-
- 2',3'-Dideoxy-3'-O-methylthymidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3’-O-Methyl Thymidine-d3
CAS:Controlled ProductApplications An intermediate in the preparation of anti-HIV pharmaceuticals
References Jie, L., et al.: J. Med. Chem., 33, 2481 (1990), McGuigan, C., et al.: Bioorg. Med. Chem. Lett., 3, 1207 (1993),Formula:C11D3H13N2O5Color and Shape:NeatMolecular weight:259.274
