CAS 108897-14-9: [3-(4-methoxybenzoyl)phenyl] acetate
Description:[3-(4-Methoxybenzoyl)phenyl] acetate, with the CAS number 108897-14-9, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with a methoxy group and an acetyl group, which contributes to its reactivity and solubility properties. The presence of the methoxy group enhances its lipophilicity, making it more soluble in organic solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests potential applications in fields such as materials science or medicinal chemistry, where modifications to aromatic compounds are common. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the methoxy and acetyl substituents, which can affect its behavior in various chemical reactions. Overall, [3-(4-methoxybenzoyl)phenyl] acetate is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C16H14O4
InChI:InChI=1/C16H14O4/c1-11(17)20-15-5-3-4-13(10-15)16(18)12-6-8-14(19-2)9-7-12/h3-10H,1-2H3
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Acetoxy-4'-methoxybenzophenone REF: 10-F201766CAS: 108897-14-9 | 90.0% | - - - | Discontinued product |
![]() | 3-Acetoxy-4'-methoxybenzophenone REF: 3D-IEA89714CAS: 108897-14-9 | Min. 95% | - - - | Discontinued product |

Ref: 10-F201766
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information |

3-Acetoxy-4'-methoxybenzophenone
Ref: 3D-IEA89714
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |