CymitQuimica logo

CAS 1088987-97-6

:

4-Bromo-1,2-dihydro-1-(4-methylphenyl)-2-oxo-3-pyridinecarboxaldehyde

Description:
4-Bromo-1,2-dihydro-1-(4-methylphenyl)-2-oxo-3-pyridinecarboxaldehyde is a chemical compound characterized by its complex structure, which includes a pyridine ring, a bromine atom, and an aldehyde functional group. This compound features a dihydropyridine framework, indicating it has undergone partial hydrogenation, which contributes to its reactivity and potential biological activity. The presence of the 4-methylphenyl group enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. The aldehyde functional group is reactive, making it a candidate for various chemical transformations, including condensation reactions. Additionally, the bromine substituent can participate in nucleophilic substitution reactions, further expanding its synthetic utility. This compound may exhibit interesting pharmacological properties, although specific biological activities would require empirical investigation. Overall, its unique structural features suggest potential applications in medicinal chemistry and organic synthesis.
Formula:C13H10BrNO2
InChI:InChI=1S/C13H10BrNO2/c1-9-2-4-10(5-3-9)15-7-6-12(14)11(8-16)13(15)17/h2-8H,1H3
InChI key:InChIKey=LJACNFZJAVGMJR-UHFFFAOYSA-N
SMILES:O=C1N(C=CC(Br)=C1C=O)C2=CC=C(C)C=C2
Synonyms:
  • 4-Bromo-1,2-dihydro-1-(4-methylphenyl)-2-oxo-3-pyridinecarboxaldehyde
  • 3-Pyridinecarboxaldehyde, 4-bromo-1,2-dihydro-1-(4-methylphenyl)-2-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.