CAS 1089-31-2
:N,N'-DIBENZYLGLYCINAMIDE
Description:
N,N'-Dibenzylglycinamide is an organic compound characterized by its structure, which features two benzyl groups attached to a glycinamide backbone. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but has limited solubility in water. It is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of various pharmaceuticals. The presence of the glycinamide moiety suggests that it may exhibit biological activity, possibly influencing neurotransmitter systems or acting as a precursor in the synthesis of more complex molecules. Additionally, N,N'-dibenzylglycinamide may undergo various chemical reactions, including acylation and alkylation, making it a versatile intermediate in organic synthesis. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate personal protective equipment to avoid inhalation or skin contact.
Formula:C16H18N2O
InChI:InChI=1/C16H18N2O/c19-16(18-12-15-9-5-2-6-10-15)13-17-11-14-7-3-1-4-8-14/h1-10,17H,11-13H2,(H,18,19)
SMILES:c1ccc(cc1)CNCC(=NCc1ccccc1)O
Synonyms:- N,N~2~-dibenzylglycinamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N,N’-Dibenzylglycinamide
CAS:Controlled ProductFormula:C16H18N2OColor and Shape:NeatMolecular weight:254.327
