CAS 108906-59-8
:AC-PHE-3-THIAPHE-OH*
Description:
AC-PHE-3-THIAPHE-OH, with the CAS number 108906-59-8, is a chemical compound that belongs to the class of phenolic compounds, characterized by the presence of a thiophene ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the functional groups present. The thiophene moiety can contribute to its electronic properties, making it of interest in various applications, including organic synthesis and materials science. Additionally, the hydroxyl (-OH) group enhances its polarity and can influence its interaction with biological systems, potentially leading to applications in pharmaceuticals or agrochemicals. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the compound's structure and purity. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C19H20N2O4S
InChI:InChI=1/C19H20N2O4S/c1-13(22)20-16(12-14-8-4-2-5-9-14)17(23)21-18(19(24)25)26-15-10-6-3-7-11-15/h2-11,16,18H,12H2,1H3,(H,20,22)(H,21,23)(H,24,25)/t16-,18-/m0/s1
Synonyms:- N-acetylphenylalanyl-3-thiaphenylalanine
- (2S)-[(N-acetyl-L-phenylalanyl)amino](phenylsulfanyl)ethanoic acid
- acetyl-l-phenylalanyl-l-3-thiaphenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Ac-Phe-Thiaphe-OH
CAS:Ac-Phe-Thiaphe-OH is a molecule that inhibits the activity of nerve growth factor (NGF) by binding to the NGF receptor. It has been shown to be effective in reducing oxidative stress and nerve injury. Ac-Phe-Thiaphe-OH also has a molecular target for cancer, as it binds to the epidermal growth factor receptor and blocks the epidermal growth factor from binding to the receptor. This leads to a decrease in cancer cell proliferation and an increase in apoptosis. Ac-Phe-Thiaphe-OH also binds to serotonin receptors and reduces pancreatic cancer cells in culture. The molecule is currently under development as a potential treatment for pancreatic cancer.
Formula:C19H20N2O4SPurity:Min. 95%Molecular weight:372.44 g/mol
