
CAS 108906-67-8
:Stereoisomer of 2,3-dihydro-5,5′,6,6′,8,8′-hexahydroxy-2,2′,3,3′-tetramethyl[9,9′-bi-4H-naphtho[2,3-b]pyran]-4,4′-dione
Description:
The chemical substance known as "Stereoisomer of 2,3-dihydro-5,5′,6,6′,8,8′-hexahydroxy-2,2′,3,3′-tetramethyl[9,9′-bi-4H-naphtho[2,3-b]pyran]-4,4′-dione" with CAS number 108906-67-8 is a complex organic compound characterized by its intricate polycyclic structure and multiple hydroxyl groups. This stereoisomer exhibits chirality, meaning it can exist in different spatial arrangements that may influence its chemical behavior and biological activity. The presence of multiple hydroxyl groups suggests potential for strong hydrogen bonding, which can affect solubility and reactivity. Additionally, the compound's structure indicates it may have significant antioxidant properties, often associated with polyphenolic compounds. Its unique arrangement of functional groups and stereochemistry may also contribute to specific interactions with biological targets, making it of interest in fields such as medicinal chemistry and pharmacology. Overall, this compound's characteristics highlight its potential utility in various applications, including as a natural product or in synthetic chemistry.
Formula:C30H24O10
InChI:InChI=1S/C30H24O10/c1-9-11(3)39-19-5-13-21(15(31)7-17(33)23(13)29(37)25(19)27(9)35)22-14-6-20-26(28(36)10(2)12(4)40-20)30(38)24(14)18(34)8-16(22)32/h5-9,11,31-34,37-38H,1-4H3
InChI key:InChIKey=OXYDHUNPMSPUCC-UHFFFAOYSA-N
SMILES:OC1=C(C2=C(C(O)=C3C(=C2)OC(C)C(C)C3=O)C(O)=C1)C=4C5=C(C(O)=C6C(=C5)OC(C)=C(C)C6=O)C(O)=CC4O
Synonyms:- Stereoisomer of 2,3-dihydro-5,5′,6,6′,8,8′-hexahydroxy-2,2′,3,3′-tetramethyl[9,9′-bi-4H-naphtho[2,3-b]pyran]-4,4′-dione
- [9,9′-Bi-4H-naphtho[2,3-b]pyran]-4,4′-dione, 2,3-dihydro-5,5′,6,6′,8,8′-hexahydroxy-2,2′,3,3′-tetramethyl-, stereoisomer
- 4H-Naphtho[2,3-b]pyran, bimol. deriv.
- Chaetochromin D
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Chaetochromin D
CAS:<p>Chaetochromin D also known as 4548-G05, is an orally active, small-molecule, selective agonist of the insulin receptor.</p>Formula:C30H24O10Color and Shape:SolidMolecular weight:544.51
