
CAS 108906-68-9
:Stereoisomer of 2,2′,3,3′-tetrahydro-5,5′,6,6′,8,8′-hexahydroxy-2,2′,3-trimethyl[9,9′-bi-4H-naphtho[2,3-b]pyran]-4,4′-dione
Description:
The chemical substance known as "Stereoisomer of 2,2′,3,3′-tetrahydro-5,5′,6,6′,8,8′-hexahydroxy-2,2′,3-trimethyl[9,9′-bi-4H-naphtho[2,3-b]pyran]-4,4′-dione," with the CAS number 108906-68-9, is a complex organic compound characterized by its intricate polycyclic structure and multiple hydroxyl groups. This stereoisomer exhibits specific spatial arrangements of its atoms, which can significantly influence its chemical reactivity and biological activity. The presence of multiple hydroxyl groups suggests potential for hydrogen bonding, which may enhance solubility in polar solvents and affect its interaction with biological systems. Additionally, the compound's structure indicates it may possess antioxidant properties, commonly associated with polyphenolic compounds. Its stereochemistry is crucial for determining its pharmacological effects, as different isomers can exhibit varying levels of activity. Overall, this substance is of interest in fields such as medicinal chemistry and materials science, where its unique properties can be harnessed for various applications.
Formula:C29H24O10
InChI:InChI=1S/C29H24O10/c1-9-4-14(30)25-19(38-9)5-12-21(15(31)7-17(33)23(12)28(25)36)22-13-6-20-26(27(35)10(2)11(3)39-20)29(37)24(13)18(34)8-16(22)32/h5-11,31-34,36-37H,4H2,1-3H3
InChI key:InChIKey=ZHECJFNKDQXHIW-UHFFFAOYSA-N
SMILES:OC1=C(C2=C(C(O)=C3C(=C2)OC(C)C(C)C3=O)C(O)=C1)C=4C5=C(C(O)=C6C(=C5)OC(C)CC6=O)C(O)=CC4O
Synonyms:- Chaetochromin C
- 4H-Naphtho[2,3-b]pyran, bimol. deriv.
- [9,9′-Bi-4H-naphtho[2,3-b]pyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,6,6′,8,8′-hexahydroxy-2,2′,3-trimethyl-, stereoisomer
- Stereoisomer of 2,2′,3,3′-tetrahydro-5,5′,6,6′,8,8′-hexahydroxy-2,2′,3-trimethyl[9,9′-bi-4H-naphtho[2,3-b]pyran]-4,4′-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Chaetochromin C
CAS:Chaetochromin C also known as 4548-G05, is an orally active, small-molecule, selective agonist of the insulin receptor.Formula:C29H24O10Color and Shape:SolidMolecular weight:532.49
