CymitQuimica logo

CAS 108915-08-8

:

Pyridine, 2-[(4S)-4,5-dihydro-4-(phenylmethyl)-2-oxazolyl]-

Description:
Pyridine, 2-[(4S)-4,5-dihydro-4-(phenylmethyl)-2-oxazolyl]- is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The specific structure includes a dihydro-oxazole moiety, which contributes to its unique properties. This compound is typically a solid or liquid at room temperature, depending on its specific formulation and purity. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological systems. The presence of the phenylmethyl group enhances its lipophilicity, which can influence its bioavailability and pharmacokinetics. Additionally, the stereochemistry indicated by the (4S) designation suggests that the compound may exhibit specific chiral properties, which can be crucial for its biological activity. Overall, this compound's characteristics make it a subject of interest in various fields, including organic synthesis and drug development.
Formula:C15H14N2O
InChI:InChI=1S/C15H14N2O/c1-2-6-12(7-3-1)10-13-11-18-15(17-13)14-8-4-5-9-16-14/h1-9,13H,10-11H2/t13-/m0/s1
InChI key:KDASQLQVBBTNJT-ZDUSSCGKSA-N
SMILES:C1[C@@H](N=C(O1)C2=CC=CC=N2)CC3=CC=CC=C3
Synonyms:
  • 4-Benzyl-2-Pyridin-2-Yl-4,5-Dihydro-1,3-Oxazole
Found 4 products.