CAS 1089212-37-2
:3-(Difluoromethyl)-1-methyl-1H-pyrazole
Description:
3-(Difluoromethyl)-1-methyl-1H-pyrazole is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two adjacent nitrogen atoms. The presence of a difluoromethyl group at the 3-position and a methyl group at the 1-position contributes to its unique chemical properties. This compound is typically colorless to pale yellow in appearance and is soluble in organic solvents. It may exhibit interesting biological activities, making it of interest in medicinal chemistry and agrochemical applications. The difluoromethyl group can enhance lipophilicity and metabolic stability, potentially influencing the compound's reactivity and interactions with biological targets. As with many pyrazole derivatives, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Safety data should be consulted for handling and storage, as the presence of fluorine atoms can impart specific toxicity and environmental considerations. Overall, 3-(Difluoromethyl)-1-methyl-1H-pyrazole represents a versatile structure in organic synthesis and pharmaceutical development.
Formula:C5H6F2N2
InChI:InChI=1S/C5H6F2N2/c1-9-3-2-4(8-9)5(6)7/h2-3,5H,1H3
InChI key:InChIKey=JQDCYDWZWBUECX-UHFFFAOYSA-N
SMILES:C(F)(F)C1=NN(C)C=C1
Synonyms:- 3-(Difluoromethyl)-1-methyl-1H-pyrazole
- 1H-Pyrazole, 3-(difluoromethyl)-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.