CAS 1089279-43-5

1,4′-Bipiperidine, 4-methyl-, hydrochloride (1:2)

Description:

1,4′-Bipiperidine, 4-methyl-, hydrochloride (1:2) is a chemical compound characterized by its bipiperidine structure, which consists of two piperidine rings connected by a carbon chain, with a methyl group attached to one of the rings. This compound is typically encountered as a hydrochloride salt, indicating that it is protonated and exists in a stable, soluble form in aqueous solutions. The presence of the hydrochloride group enhances its solubility and stability, making it suitable for various applications in organic synthesis and medicinal chemistry. The compound may exhibit properties such as basicity due to the nitrogen atoms in the piperidine rings, which can participate in hydrogen bonding and interact with biological targets. Its structural features suggest potential uses in the development of pharmaceuticals, particularly in the synthesis of compounds with neuroactive properties. As with many chemical substances, safety precautions should be observed when handling it, including the use of appropriate personal protective equipment and adherence to safety guidelines.

Formula: C₁₁H₂₂N₂·2ClH

InChI: InChI=1S/C11H22N2.2ClH/c1-10-4-8-13(9-5-10)11-2-6-12-7-3-11;;/h10-12H,2-9H2,1H3;2*1H

InChI key: InChIKey=SNIWOBHYOOBKQS-UHFFFAOYSA-N

SMILES: CC1CCN(CC1)C2CCNCC2.Cl

Synonyms:

• 1,4′-Bipiperidine, 4-methyl-, hydrochloride (1:2)
• 4-Methyl-1,4′-bipiperidine dihydrochloride