CAS 108929-11-9
:1,N(2)-ethenodeoxyguanosine
Description:
1,N(2)-Ethenodeoxyguanosine is a modified nucleoside that arises from the reaction of deoxyguanosine with certain electrophiles, particularly in the context of DNA damage caused by environmental factors such as alkylating agents or oxidative stress. This compound features an etheno group at the N(2) position of the guanine base, which can lead to mispairing during DNA replication, potentially resulting in mutations. The presence of the etheno modification can affect the stability and structure of DNA, influencing its interactions with enzymes and other biomolecules. As a result, 1,N(2)-ethenodeoxyguanosine is often studied in the context of mutagenesis and carcinogenesis. Its detection and quantification in biological samples can provide insights into the extent of DNA damage and the cellular response to genotoxic stress. The compound is also of interest in the field of cancer research, as understanding its formation and repair mechanisms may contribute to the development of therapeutic strategies targeting DNA damage.
Formula:C12H13N5O4
InChI:InChI=1/C12H13N5O4/c18-4-7-6(19)3-8(21-7)17-5-14-9-10(17)15-12-13-1-2-16(12)11(9)20/h1-2,5-8,18-19H,3-4H2,(H,13,15)/t6-,7+,8-/m0/s1
Synonyms:- 1,N(2)-Edguo
- 9H-Imidazo(1,2-a)purin-9-one, 3-(2-deoxy-beta-D-erythro-pentofuranosyl)-3,4-dihydro-
- 3-(2-deoxy-alpha-D-erythro-pentofuranosyl)-3,4-dihydro-9H-imidazo[1,2-a]purin-9-one
- 1,N(2)-Ethenodeoxyguanosine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1, N2-Etheno-2'-deoxyguanosine-13C5
CAS:Controlled Product<p>Applications 1, N2-Etheno-2’-deoxyguanosine-13C5 is caused by exposure to pollutants. It is an isotopically labeled analog of the 2’-Deoxyguanosine adduct.<br></p>Formula:C713C5H13N5O4Color and Shape:NeatMolecular weight:296.231, N2-Etheno-2-deoxyguanosine
CAS:<p>Please enquire for more information about 1, N2-Etheno-2-deoxyguanosine including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C12H13N5O4Purity:Min. 95%Molecular weight:291.26 g/mol

