CAS 108944-67-8: Neocurdione
Description:Neocurdione is a naturally occurring sesquiterpene compound, primarily derived from certain plant species, particularly those in the Asteraceae family. It is characterized by its unique bicyclic structure, which contributes to its distinctive chemical properties and biological activities. Neocurdione is known for its potential therapeutic applications, including anti-inflammatory, antimicrobial, and anticancer effects, making it of interest in pharmaceutical research. The compound typically exhibits a moderate to high degree of lipophilicity, allowing it to interact effectively with biological membranes. Its molecular formula and specific stereochemistry play crucial roles in its reactivity and interaction with various biological targets. Additionally, neocurdione's volatility and solubility in organic solvents make it suitable for extraction and purification processes in laboratory settings. Overall, neocurdione represents a fascinating subject of study within the field of natural products chemistry, with ongoing research aimed at elucidating its mechanisms of action and potential applications in medicine.
Formula:C15H24O2
InChI:InChI=1S/C15H24O2/c1-10(2)13-9-14(16)12(4)7-5-6-11(3)8-15(13)17/h6,10,12-13H,5,7-9H2,1-4H3/b11-6+/t12-,13+/m0/s1
InChI key:InChIKey=KDPFMRXIVDLQKX-OAIDTJHVSA-N
SMILES:O=C1CC(=CCCC(C(=O)CC1C(C)C)C)C
- Synonyms:
- (-)-Neocurdione
- (3R,6E,10S)-6,10-Dimethyl-3-(1-methylethyl)-6-cyclodecene-1,4-dione
- (3R,6E,10S)-6,10Α-Dimethyl-3-Isopropyl-6-Cyclodecene-1,4-Dione
- 6-Cyclodecene-1,4-dione,6,10-dimethyl-3-(1-methylethyl)-, [3R-(3R*,6E,10S*)]-
- 6-Cyclodecene-1,4-dione, 6,10-dimethyl-3-(1-methylethyl)-, (3R,6E,10S)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Neocurdione REF: 7W-GY3387CAS: 108944-67-8 | - - - | To inquire | Fri 28 Mar 25 |
![]() | Neocurdione REF: BP-BP3671CAS: 108944-67-8 | 95%~99% | 339.00 € | Tue 01 Apr 25 |
![]() | Neocurdione REF: 3D-FN74271CAS: 108944-67-8 | Min. 95% | - - - | Discontinued product |

Ref: 7W-GY3387
Undefined size | To inquire |

Ref: BP-BP3671
5mg | 339.00 € |

Neocurdione
Ref: 3D-FN74271
1mg | Discontinued | Request information | |
2mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information |