CymitQuimica logo

CAS 1089669-72-6

:

B-[2-(1-Methylethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]boronic acid

Description:
B-[2-(1-Methylethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]boronic acid, with the CAS number 1089669-72-6, is a boronic acid derivative characterized by its unique structural features that include a pyrrolo[2,3-b]pyridine core and a branched alkyl substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. The presence of the boron atom contributes to its reactivity, particularly in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, the specific arrangement of the pyridine and pyrrole rings may impart distinct electronic properties, influencing its biological activity and potential as a pharmaceutical agent. Overall, this compound's characteristics make it a valuable candidate for research in drug development and materials science.
Formula:C10H13BN2O2
InChI:InChI=1S/C10H13BN2O2/c1-6(2)9-5-7-8(11(14)15)3-4-12-10(7)13-9/h3-6,14-15H,1-2H3,(H,12,13)
InChI key:InChIKey=JFGSDEHGDZXCNJ-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C2C(NC(C(C)C)=C2)=NC=C1
Synonyms:
  • [2-(Propan-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]boronic acid
  • B-[2-(1-Methylethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]boronic acid
  • (2-Propan-2-yl-1H-pyrrolo[2,3-b]pyridin-4-yl)boronic acid
  • Boronic acid, B-[2-(1-methylethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.