CAS 1089682-04-1

6-Chloro-2-benzofuranmethanol

Description:

6-Chloro-2-benzofuranmethanol is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and a chloro substituent at the 6-position. This compound typically exhibits properties associated with both aromatic and alcohol functionalities, which can influence its reactivity and solubility. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry due to the presence of the benzofuran structure, which is known for various biological activities. The chloro group may enhance its reactivity, making it a candidate for further chemical modifications. Additionally, the presence of the hydroxymethyl group suggests potential for hydrogen bonding, which can affect its interactions in biological systems. Safety data sheets would provide information on its toxicity, handling, and storage requirements, as with many organic compounds. Overall, 6-Chloro-2-benzofuranmethanol represents a compound of interest in research and development, particularly in the fields of pharmaceuticals and organic synthesis.

Formula: C₉H₇ClO₂

InChI: InChI=1S/C9H7ClO2/c10-7-2-1-6-3-8(5-11)12-9(6)4-7/h1-4,11H,5H2

InChI key: InChIKey=RSGHWMDNXKGGKG-UHFFFAOYSA-N

SMILES: C(O)C1=CC=2C(O1)=CC(Cl)=CC2

Synonyms:

• (6-Chloro-1-benzofuran-2-yl)methanol
• 6-Chloro-2-benzofuranmethanol
• (6-Chlorobenzofuran-2-yl)methanol
• 2-Benzofuranmethanol, 6-chloro-