
CAS 1089682-06-3
:6-Bromo-2-benzofuranmethanol
Description:
6-Bromo-2-benzofuranmethanol is an organic compound characterized by its unique structure, which includes a benzofuran moiety and a bromine substituent at the 6-position. This compound typically exhibits properties associated with both aromatic and alcohol functionalities, contributing to its potential reactivity and solubility in various solvents. The presence of the bromine atom can enhance its electrophilic character, making it a candidate for further chemical transformations, such as nucleophilic substitutions or coupling reactions. Additionally, the benzofuran structure may impart biological activity, as many benzofuran derivatives are known for their pharmacological properties. The compound's molecular weight, boiling point, and melting point would depend on its specific structural features and intermolecular interactions. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 6-Bromo-2-benzofuranmethanol represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C9H7BrO2
InChI:InChI=1S/C9H7BrO2/c10-7-2-1-6-3-8(5-11)12-9(6)4-7/h1-4,11H,5H2
InChI key:InChIKey=SYECKXDQCBDFFX-UHFFFAOYSA-N
SMILES:C(O)C1=CC=2C(O1)=CC(Br)=CC2
Synonyms:- 2-Benzofuranmethanol, 6-bromo-
- (6-Bromo-1-benzofuran-2-yl)methanol
- (6-Bromobenzofuran-2-yl)methanol
- 6-Bromo-2-benzofuranmethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.