CAS 1089687-05-7

2,6-dibromo-4,4-bis(2-ethylhexyl)-4h-silolo(3,2-b:4,5-b')dithiophene

Description:

2,6-Dibromo-4,4-bis(2-ethylhexyl)-4H-silolo(3,2-b:4,5-b')dithiophene is a specialized organic compound characterized by its unique molecular structure, which includes a silolo group and dithiophene units. This compound typically exhibits properties such as high thermal stability and good solubility in organic solvents, making it suitable for applications in organic electronics, particularly in organic photovoltaics and field-effect transistors. The presence of bromine atoms enhances its electronic properties and facilitates further functionalization. Additionally, the long alkyl chains (2-ethylhexyl groups) contribute to its solubility and processability, which are crucial for device fabrication. The compound's conjugated system allows for effective charge transport, while its silolo structure can improve the overall stability and performance of electronic devices. Overall, 2,6-dibromo-4,4-bis(2-ethylhexyl)-4H-silolo(3,2-b:4,5-b')dithiophene represents a significant material in the field of organic semiconductors, with potential for advancements in flexible and efficient electronic applications.

Formula: C₂₄H₃₆Br₂S₂Si

InChI: InChI=1S/C24H36Br2S2Si/c1-5-9-11-17(7-3)15-29(16-18(8-4)12-10-6-2)19-13-21(25)27-23(19)24-20(29)14-22(26)28-24/h13-14,17-18H,5-12,15-16H2,1-4H3

SMILES: CCCCC(CC)C[Si]1(CC(CC)CCCC)c2cc(Br)sc2c2c1cc(Br)s2

Synonyms:

• K0103
• 2,6-Dibromo-(4,4-di-2-ethylhexyl-dithieno[3,2-b:2',3'-d]silole)
• 2,6-Dibromo-4,4-Bis(2-Ethylhexyl)-4H-Silolo[3,2-B:4,5-B']Dithiophene

2,6-Dibromo-4,4-bis(2-ethylhexyl)-4H-silolo[3,2-b

CAS: 1089687-05-7

Formula: C₂₄H₃₆Br₂S₂Si

Purity: 97%

Color and Shape: Liquid

Molecular weight: 576.5661

Ref: IN-DA0091ZB

2,6-Dibromo-4,4-bis(2-ethylhexyl)-4H-silolo[3,2-b:4,5-b']dithiophene

CAS: 1089687-05-7

2,6-Dibromo-4,4-bis(2-ethylhexyl)-4H-silolo[3,2-b:4,5-b']dithiophene

Purity: 95%

Molecular weight: 576.58g/mol

Ref: 54-OR1045080