CymitQuimica logo

CAS 1089695-63-5

:

rel-(1R,3S)-3-[(Phenylmethyl)amino]cyclohexanol

Description:
Rel-(1R,3S)-3-[(Phenylmethyl)amino]cyclohexanol, identified by its CAS number 1089695-63-5, is a chiral organic compound characterized by its cyclohexanol backbone, which features a phenylmethylamino substituent. This compound exhibits stereochemistry, with specific configurations at the 1 and 3 positions of the cyclohexanol ring, contributing to its potential biological activity and interactions. The presence of the phenylmethyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. As a secondary amine, it can participate in hydrogen bonding and may interact with various biological targets, making it of interest in medicinal chemistry. The compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through spectroscopic methods and biological assays to determine its efficacy and safety profiles.
Formula:C13H19NO
InChI:InChI=1/C13H19NO/c15-13-8-4-7-12(9-13)14-10-11-5-2-1-3-6-11/h1-3,5-6,12-15H,4,7-10H2/t12-,13+/s2
InChI key:InChIKey=ADACSZOIFGMJFT-QWAQRTLVNA-N
SMILES:N(CC1=CC=CC=C1)[C@@H]2C[C@H](O)CCC2
Synonyms:
  • Cyclohexanol, 3-[(phenylmethyl)amino]-, (1R,3S)-rel-
  • rel-(1R,3S)-3-[(Phenylmethyl)amino]cyclohexanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.