CymitQuimica logo

CAS 108982-42-9

:

2-(diethylamino)ethyl [3-(2-methoxyethoxy)phenyl]carbamate

Description:
2-(Diethylamino)ethyl [3-(2-methoxyethoxy)phenyl]carbamate, with the CAS number 108982-42-9, is a chemical compound characterized by its carbamate functional group, which is known for its applications in pharmaceuticals and agrochemicals. This compound features a diethylamino group, contributing to its potential as a base and influencing its solubility and reactivity. The presence of the 3-(2-methoxyethoxy)phenyl moiety suggests that it may exhibit interesting electronic properties and steric effects, which can affect its biological activity. The structure indicates that it may interact with biological targets, potentially serving as a lead compound in drug development. Its molecular characteristics, including molecular weight and polarity, would influence its pharmacokinetics and pharmacodynamics. Additionally, the compound's stability, solubility in various solvents, and reactivity with other chemical species are essential for understanding its behavior in different environments. Overall, this compound's unique structure positions it as a candidate for further investigation in medicinal chemistry and related fields.
Formula:C16H26N2O4
InChI:InChI=1/C16H26N2O4/c1-4-18(5-2)9-10-22-16(19)17-14-7-6-8-15(13-14)21-12-11-20-3/h6-8,13H,4-5,9-12H2,1-3H3,(H,17,19)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.