CAS 108985-27-9: 2-HEPTYL-3-HYDROXY-4-QUINOLONE
Description:2-Heptyl-3-hydroxy-4-quinolone, with the CAS number 108985-27-9, is a chemical compound that belongs to the class of quinolones, which are characterized by a bicyclic structure containing a quinoline moiety. This particular compound features a heptyl side chain at the 2-position and a hydroxyl group at the 3-position, contributing to its unique properties. It is known for its potential biological activities, including antimicrobial and antifungal properties, making it of interest in pharmaceutical research. The presence of the hydroxyl group enhances its solubility in polar solvents, while the heptyl chain may influence its lipophilicity and membrane permeability. Additionally, the compound may exhibit various reactivity patterns typical of quinolones, such as the ability to form chelates with metal ions. Its stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature, which are important considerations in its application and study. Overall, 2-heptyl-3-hydroxy-4-quinolone represents a significant compound in the field of medicinal chemistry.
Formula:C16H21NO2
InChI:InChI=1/C16H21NO2/c1-2-3-4-5-6-11-14-16(19)15(18)12-9-7-8-10-13(12)17-14/h7-10,19H,2-6,11H2,1H3,(H,17,18)
- Synonyms:
- 2-Heptyl-3-hydroxyquinolin-4(1H)-one
- 4(1H)-quinolinone, 2-heptyl-3-hydroxy-
