CAS 109012-23-9

Ethyl 1-methyl-4-nitroimidazole-2-carboxylate

Description:

Ethyl 1-methyl-4-nitroimidazole-2-carboxylate is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing nitrogen atoms. This compound features a nitro group (-NO2) and a carboxylate group (-COOEt) attached to the imidazole ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the ethyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions. Ethyl 1-methyl-4-nitroimidazole-2-carboxylate is often studied for its biological activity, particularly in the context of pharmaceuticals, where imidazole derivatives are known for their antimicrobial and antifungal properties. Additionally, the nitro group can participate in reduction reactions, leading to further functionalization. Safety data should be consulted for handling and storage, as compounds with nitro groups can pose hazards. Overall, this compound exemplifies the diverse chemistry of imidazole derivatives and their potential utility in medicinal chemistry and material science.

Formula: C₇H₉N₃O₄

InChI: InChI=1/C7H9N3O4/c1-3-14-7(11)6-8-5(10(12)13)4-9(6)2/h4H,3H2,1-2H3

SMILES: CCOC(=O)c1nc(cn1C)N(=O)=O

Synonyms:

• 1H-Imidazole-2-carboxylic acid, 1-methyl-4-nitro-, ethyl ester
• Ethyl 1-methyl-4-nitro-1H-imidazole-2-carboxylate

Ethyl 1-methyl-4-nitro-1H-imidazole-2-carboxylate

CAS: 109012-23-9

Formula: C₇H₉N₃O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 199.1641

Ref: IN-DA007BJG

Ethyl 1-methyl-4-nitro-1H-imidazole-2-carboxylate

CAS: 109012-23-9

Ethyl 1-methyl-4-nitro-1H-imidazole-2-carboxylate

Purity: 98%

Molecular weight: 199.16g/mol

Ref: 54-OR52509

Ethyl-1-methyl-4-nitroimidazole-2-carboxylate

CAS: 109012-23-9

Formula: C₇H₉N₃O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 199.166

Ref: 10-F018813

Ethyl 1-methyl-4-nitroimidazole-2-carboxylate

Controlled Product

CAS: 109012-23-9

Applications Ethyl 1-methyl-4-nitroimidazole-2-carboxylate

Formula: C₇H₉N₃O₄

Color and Shape: Neat

Molecular weight: 199.16

Ref: TR-E925628