CAS 109024-53-5
:quin-MF
Description:
Quin-MF, identified by its CAS number 109024-53-5, is a chemical compound that belongs to the class of quinoline derivatives. It is characterized by its unique molecular structure, which typically includes a quinoline core fused with additional functional groups that enhance its chemical reactivity and biological activity. Quin-MF is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The compound may exhibit properties such as antimicrobial, antitumor, or anti-inflammatory activities, making it of interest in drug discovery. Additionally, its solubility, stability, and reactivity can vary based on the specific substituents attached to the quinoline framework. As with many chemical substances, safety and handling precautions are essential, as quinoline derivatives can pose health risks if not managed properly. Overall, Quin-MF represents a significant area of research within organic and medicinal chemistry, contributing to advancements in therapeutic agents.
Formula:C25H24FN3O9
InChI:InChI=1/C25H24FN3O9/c1-14-7-19(29(11-23(34)35)12-24(36)37)20(8-17(14)26)38-13-16-6-5-15-3-2-4-18(25(15)27-16)28(9-21(30)31)10-22(32)33/h2-8H,9-13H2,1H3,(H,30,31)(H,32,33)(H,34,35)(H,36,37)
SMILES:Cc1cc(c(cc1F)OCc1ccc2cccc(c2n1)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
Synonyms:- 2-(2-Amino-4-methyl-5-fluorophenoxy)methyl-8-aminoquinoline-N,N,N',N'-tetraacetic acid
- Quinmf
- Glycine, N-(2-((2-(bis(carboxymethyl)amino)-5-fluoro-4-methylphenoxy)methyl)-8-quinolinyl)-N-(carboxymethyl)-
- {[2-({2-[Bis(Carboxymethyl)Amino]-5-Fluoro-4-Methylphenoxy}Methyl)Quinolin-8-Yl](Carboxymethyl)Amino}Acetic Acid
- Quin-MF
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.