CymitQuimica logo

CAS 109025-26-5

:

5-(4-methoxy-3,5-dimethyl-phenyl)-5-oxo-pentanoic acid

Description:
5-(4-Methoxy-3,5-dimethyl-phenyl)-5-oxo-pentanoic acid, with the CAS number 109025-26-5, is an organic compound characterized by its complex structure, which includes a pentanoic acid backbone and a substituted aromatic ring. The presence of a methoxy group and two methyl groups on the aromatic ring contributes to its hydrophobic characteristics, while the carboxylic acid functional group provides acidic properties. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic nature. Its structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, particularly in the development of biologically active molecules. The compound may also participate in various chemical reactions, including esterification and acylation, due to the reactivity of the carboxylic acid group. Overall, its unique combination of functional groups and structural features makes it a compound of interest in both research and industrial applications.
Formula:C14H18O4
InChI:InChI=1/C14H18O4/c1-9-7-11(8-10(2)14(9)18-3)12(15)5-4-6-13(16)17/h7-8H,4-6H2,1-3H3,(H,16,17)
SMILES:Cc1cc(cc(C)c1OC)C(=O)CCCC(=O)O
Found 1 products.