CAS 109025-40-3

3-(4-Methoxy-3,5-dimethylphenyl)-2-propenoic acid

Description:

3-(4-Methoxy-3,5-dimethylphenyl)-2-propenoic acid, with the CAS number 109025-40-3, is an organic compound characterized by its structure, which features a propenoic acid backbone substituted with a methoxy group and two methyl groups on a phenyl ring. This compound typically exhibits properties associated with both aromatic and unsaturated carboxylic acids, including potential reactivity in various chemical reactions such as esterification and polymerization. The presence of the methoxy group can influence its solubility and polarity, making it more soluble in organic solvents. Additionally, the methyl groups may affect its steric hindrance and electronic properties, potentially enhancing its reactivity or stability. This compound may also exhibit biological activity, which could be of interest in pharmaceutical or agrochemical applications. Overall, its unique structural features contribute to its potential utility in various chemical and industrial processes.

Formula: C₁₂H₁₄O₃

InChI: InChI=1S/C12H14O3/c1-8-6-10(4-5-11(13)14)7-9(2)12(8)15-3/h4-7H,1-3H3,(H,13,14)

InChI key: InChIKey=LYWLBISODFQMLI-UHFFFAOYSA-N

SMILES: O(C)C1=C(C)C=C(C=CC(O)=O)C=C1C

Synonyms:

• 3-(4-Methoxy-3,5-dimethylphenyl)-2-propenoic acid
• 2-Propenoic acid, 3-(4-methoxy-3,5-dimethylphenyl)-