CAS 109029-99-4

4-Chloro-3-[[(4-methoxyphenyl)amino]sulfonyl]benzoic acid

Description:

4-Chloro-3-[[(4-methoxyphenyl)amino]sulfonyl]benzoic acid, with the CAS number 109029-99-4, is an organic compound characterized by its complex structure, which includes a benzoic acid core substituted with a chloro group and a sulfonamide moiety. This compound features a sulfonyl group attached to an amino group, which is further substituted with a methoxyphenyl group, contributing to its potential biological activity. The presence of the chloro substituent enhances its reactivity and may influence its pharmacological properties. Typically, compounds of this nature are investigated for their potential applications in pharmaceuticals, particularly as anti-inflammatory or analgesic agents. The sulfonamide functional group is known for its role in various medicinal chemistry applications, often exhibiting antibacterial properties. Additionally, the methoxy group can enhance lipophilicity, potentially affecting the compound's solubility and permeability. Overall, 4-Chloro-3-[[(4-methoxyphenyl)amino]sulfonyl]benzoic acid represents a class of compounds with diverse applications in medicinal chemistry and drug development.

Formula: C₁₄H₁₂ClNO₅S

InChI: InChI=1S/C14H12ClNO5S/c1-21-11-5-3-10(4-6-11)16-22(19,20)13-8-9(14(17)18)2-7-12(13)15/h2-8,16H,1H3,(H,17,18)

InChI key: InChIKey=DRZUKKVFQKGWOJ-UHFFFAOYSA-N

SMILES: S(NC1=CC=C(OC)C=C1)(=O)(=O)C2=CC(C(O)=O)=CC=C2Cl

Synonyms:

• 4-Chloro-3-[[(4-methoxyphenyl)amino]sulfonyl]benzoic acid
• Benzoic acid, 4-chloro-3-[[(4-methoxyphenyl)amino]sulfonyl]-

4-Chloro-3-[(4-methoxyphenyl)sulfamoyl]benzoic acid

CAS: 109029-99-4

Versatile small molecule scaffold

Formula: C₁₄H₁₂ClNO₅S

Purity: Min. 95%

Molecular weight: 341.8 g/mol

Ref: 3D-JEA02999