CymitQuimica logo

CAS 109032-69-1

:

2-Amino-N-(4-methylphenyl)propanamide

Description:
2-Amino-N-(4-methylphenyl)propanamide, also known by its CAS number 109032-69-1, is an organic compound characterized by the presence of an amino group and an amide functional group. This compound features a propanamide backbone with a 4-methylphenyl substituent, which contributes to its aromatic properties. The molecular structure indicates that it has both polar and non-polar characteristics, making it potentially soluble in various solvents. The presence of the amino group suggests that it can participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its melting point, boiling point, and specific reactivity would depend on the molecular interactions and the environment in which it is studied. Overall, 2-Amino-N-(4-methylphenyl)propanamide is a compound of interest in organic chemistry and medicinal chemistry due to its functional groups and potential applications.
Formula:C10H14N2O
InChI:InChI=1S/C10H14N2O/c1-7-3-5-9(6-4-7)12-10(13)8(2)11/h3-6,8H,11H2,1-2H3,(H,12,13)
InChI key:InChIKey=NUCATNXWTKMKFU-UHFFFAOYSA-N
SMILES:N(C(C(C)N)=O)C1=CC=C(C)C=C1
Synonyms:
  • Propanamide, 2-amino-N-(4-methylphenyl)-
  • 2-Amino-N-(4-methylphenyl)propanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.