
CAS 109037-76-5
:Benzene, reaction products with chlorine and sulfur chloride (S2Cl2), chlorides
Description:
The chemical substance known as "Benzene, reaction products with chlorine and sulfur chloride (S2Cl2), chlorides," with the CAS number 109037-76-5, is a complex mixture resulting from the chlorination of benzene in the presence of sulfur dichloride. This substance typically contains various chlorinated aromatic compounds, which may exhibit a range of physical and chemical properties. The presence of chlorine atoms introduces significant reactivity, making these compounds useful in various chemical syntheses and industrial applications. The chlorinated products can vary in their boiling points, solubility, and stability, depending on the degree of chlorination and the specific structural arrangements of the resulting molecules. Additionally, these compounds may possess distinct odor characteristics and can be hazardous, necessitating careful handling and storage. Due to their potential environmental and health impacts, regulatory considerations are important when working with or disposing of these substances. Overall, the reaction products of benzene with chlorine and sulfur chloride represent a significant area of interest in organic chemistry and industrial applications.
Formula:C6H6·Cl2S2·Cl2
InChI:InChI=1S/C6H6.Cl2S2.Cl2/c1-2-4-6-5-3-1;1-3-4-2;1-2/h1-6H;;
InChI key:InChIKey=VWQDLARRABLIAP-UHFFFAOYSA-N
SMILES:S(SCl)Cl.ClCl.C=1C=CC=CC1
Synonyms:- Benzene, reaction products with chlorine and sulfur chloride (S2Cl2), chlorides
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
