CAS 109072-26-6

2-Pentyl-4(1H)-quinolinone

Description:

2-Pentyl-4(1H)-quinolinone, identified by its CAS number 109072-26-6, is a chemical compound that belongs to the class of quinolinones, which are heterocyclic compounds featuring a quinoline structure with a carbonyl group. This compound typically exhibits a yellow to brownish color and is characterized by its aromatic properties due to the presence of the quinoline ring. It is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmaceutical research. The presence of the pentyl group contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. Additionally, 2-Pentyl-4(1H)-quinolinone may participate in various chemical reactions, such as electrophilic substitutions, due to the reactivity of the quinoline moiety. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Overall, this compound's unique structure and properties make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₄H₁₇NO

InChI: InChI=1S/C14H17NO/c1-2-3-4-7-11-10-14(16)12-8-5-6-9-13(12)15-11/h5-6,8-10H,2-4,7H2,1H3,(H,15,16)

InChI key: InChIKey=IASGNHXZHCRCBY-UHFFFAOYSA-N

SMILES: O=C1C=2C(NC(CCCCC)=C1)=CC=CC2

Synonyms:

• 2-Pentyl-4(1H)-quinolinone
• 2-Pentyl-4(1H)-quinolone
• 4(1H)-Quinolinone, 2-pentyl-
• Pseudane V

Pseudane V

CAS: 109072-26-6

Pseudane V

Purity: ≥98%

Molecular weight: 215.29g/mol

Ref: 54-BUP02070

Pseudane V

CAS: 109072-26-6

Pseudane V (2-pentylquinolin-4-ol) is a marine derived natural products found in Pseudoalteromonas sp. M2.

Formula: C₁₄H₁₇NO

Purity: >99.99%

Color and Shape: Soild

Molecular weight: 215.29

Ref: TM-TN7210

2-Pentyl-1,4-dihydroquinolin-4-one

CAS: 109072-26-6

Versatile small molecule scaffold

Formula: C₁₄H₁₇NO

Purity: Min. 95%

Molecular weight: 215.3 g/mol

Ref: 3D-JEA07226