CAS 109074-67-1
:2-(Trifluoromethyl)pyrrolidine
Description:
2-(Trifluoromethyl)pyrrolidine is a chemical compound characterized by its pyrrolidine ring, which is a five-membered saturated heterocycle containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the second position of the pyrrolidine ring significantly influences its chemical properties, including its reactivity and polarity. This compound is typically colorless to pale yellow in appearance and is known for its relatively low boiling point and moderate solubility in organic solvents. The trifluoromethyl group enhances the lipophilicity of the molecule, making it of interest in medicinal chemistry and material science. Additionally, 2-(Trifluoromethyl)pyrrolidine may exhibit unique biological activities, which can be attributed to the electronic effects of the trifluoromethyl substituent. Its synthesis often involves the reaction of pyrrolidine derivatives with trifluoromethylating agents. As with many fluorinated compounds, it is essential to handle this substance with care due to potential environmental and health impacts associated with fluorinated chemicals.
Formula:C5H8F3N
InChI:InChI=1/C5H8F3N/c6-5(7,8)4-2-1-3-9-4/h4,9H,1-3H2/t4-/m1/s1
SMILES:C1C[C@H](C(F)(F)F)NC1
Synonyms:- DL-2-Trifluoromethylpyrrolidine
- (R)-(-)-2-(Trifluoromethyl)PYRROLIDINE
- 2(R)-2-(Trifluoromethyl)pyrrolidine
- 1,1'-(1,1,1,3,3,3-Hexafluoropropane-2,2-Diyl)Bis(4-Methylbenzene)
- (2R)-2-(trifluoromethyl)pyrrolidine
- Pyrrolidine, 2-(trifluoromethyl)-
- 1-Aza-2-(trifluoromethyl)cyclopentane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(+/-)-2-(Trifluoromethyl)pyrrolidine, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C5H8F3NPurity:95%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:139.12(R)-(-)-2-(Trifluoromethyl)pyrrolidine
CAS:Formula:C5H8F3NPurity:97%Color and Shape:LiquidMolecular weight:139.11892-(Trifluoromethyl)pyrrolidine
CAS:<p>2-(Trifluoromethyl)pyrrolidine</p>Formula:C5H8F3NPurity:97%Color and Shape: clear. pale yellow liquidMolecular weight:139.12g/molDL-2-Trifluoromethylpyrrolidine
CAS:Formula:C5H8F3NPurity:≥97%Color and Shape:Solid, Low Melting SolidMolecular weight:139.121



