CAS 109105-51-3: 1-Benzyl-hexahydro-4H-azepin-4-amine
Description:1-Benzyl-hexahydro-4H-azepin-4-amine, with the CAS number 109105-51-3, is a chemical compound characterized by its bicyclic structure, which includes a hexahydroazepine ring. This compound features a benzyl group attached to the nitrogen atom of the azepine, contributing to its unique properties. It is typically classified as an amine due to the presence of an amino group (-NH2) in its structure. The compound may exhibit moderate to high solubility in organic solvents, depending on the specific conditions, and it may have potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural features suggest that it could interact with biological systems, possibly acting as a ligand for various receptors. Additionally, the presence of the benzyl group may enhance its lipophilicity, influencing its pharmacokinetic properties. As with many amines, it may also participate in hydrogen bonding, affecting its reactivity and interactions in chemical processes. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C13H20N2
InChI:InChI=1/C13H20N2/c14-13-7-4-9-15(10-8-13)11-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11,14H2
- Synonyms:
- 1-Benzylazepan-4-Amine
Ref: 10-F765847
| 250mg | To inquire |
1-Benzylazepan-4-amine hydrochloride
Ref: 3D-JEA10551
| 250mg | 463.00 € | ||
| 2500mg | 1,252.00 € |
