CAS 109114-00-3
:2-(trifluoromethyl)imidazo[1,2-b]pyridazine
Description:
2-(Trifluoromethyl)imidazo[1,2-b]pyridazine is a heterocyclic compound characterized by the presence of both imidazole and pyridazine rings, which contribute to its unique chemical properties. The trifluoromethyl group (-CF3) attached to the imidazole ring enhances the compound's lipophilicity and can influence its reactivity and biological activity. This compound typically exhibits a planar structure due to the aromatic nature of the rings, which can facilitate π-π stacking interactions. It is often studied for its potential applications in medicinal chemistry, particularly as a scaffold for developing pharmaceuticals, owing to its ability to interact with biological targets. The presence of fluorine atoms generally increases the metabolic stability of the compound, making it an attractive candidate in drug design. Additionally, the compound may exhibit interesting electronic properties due to the electronegative trifluoromethyl group, which can affect its interaction with other molecules. Overall, 2-(trifluoromethyl)imidazo[1,2-b]pyridazine is a versatile compound with significant implications in various fields, including organic synthesis and pharmacology.
Formula:C7H4F3N3
InChI:InChI=1/C7H4F3N3/c8-7(9,10)5-4-13-6(12-5)2-1-3-11-13/h1-4H
SMILES:c1cc2nc(cn2nc1)C(F)(F)F
Synonyms:- Imidazo[1,2-B]Pyridazine, 2-(Trifluoromethyl)-
- 2-(Trifluoromethyl)imidazo[1,2-b]pyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

