CAS 109120-55-0
:(2R,3S)-3-PHENYLSERINE
Description:
(2R,3S)-3-Phenylserine is an amino acid derivative characterized by its specific stereochemistry, indicated by the (2R,3S) configuration. This compound features a phenyl group attached to the beta carbon of the serine backbone, which contributes to its unique properties and potential biological activities. As a non-proteinogenic amino acid, it is not incorporated into proteins but may play roles in various biochemical pathways. The presence of the phenyl group enhances its hydrophobic character, influencing its interactions in biological systems. (2R,3S)-3-Phenylserine may exhibit neuroprotective effects and has been studied for its potential applications in pharmaceuticals, particularly in the context of neurological disorders. Its solubility in water is moderate, typical for amino acids, and it can participate in hydrogen bonding due to the hydroxyl group present in the serine structure. Overall, (2R,3S)-3-Phenylserine is of interest in both synthetic chemistry and medicinal research, warranting further investigation into its properties and applications.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c10-7(9(12)13)8(11)6-4-2-1-3-5-6/h1-5,7-8,11H,10H2,(H,12,13)/t7-,8+/m1/s1
Synonyms:- D-Threo-3-phenylserine
- (betaS)-beta-hydroxy-D-phenylalanine
- (2R,3S)-3-PHENYLSERINE
- (2R,3S)-2-Amino-3-hydroxy-3-phenylpropionic acid
- (2R,3S)-2-Amino-3-phenyl-3-hydroxypropionic acid
- REF DUPL: Threo-D-Phenylserine
- D-threo-β-Phenylserine
- (2R,3S)-2-amino-3-hydroxy-3-phenylpropanoic acid
- (2R,3S)-3-phenylderine
- (2R,3S)-Phenyserine
- threo-beta-Hydroxy-D-phenylalanine
- (2R,3S)-3-Phenyl-D-serine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2R,3S)-3-Phenylserine
CAS:(2R,3S)-3-PhenylserinePurity:≥95%Color and Shape:White PowderMolecular weight:181.19g/molD-threo-β-Phenylserine
CAS:Controlled ProductFormula:C9H11NO3Color and Shape:NeatMolecular weight:181.189(2R,3S)-3-Phenylserine
CAS:(2R,3S)-3-Phenylserine is a copper complex of an ester hydrochloride that has been used in the synthesis of proteins. The asymmetric synthesis of this molecule was achieved by using hydrogen fluoride as a catalyst and high salt as an additive. (2R,3S)-3-Phenylserine has also been shown to be a substrate for racemase, which converts it to its natural form - L-phenylalanine. (2R,3S)-3-Phenylserine has been used in tissue culture studies to produce proteins from amino acids. (2R,3S)-3-Phenylserine is also known to have a neutral ph and can be found in agarose gels.
Formula:C9H11NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:181.19 g/molRef: 3D-FP178398
Discontinued product


