CymitQuimica logo

CAS 109125-52-2

:

Thiamine Disulfide Nitrate

Description:
Thiamine Disulfide Nitrate, also known by its CAS number 109125-52-2, is a derivative of thiamine (vitamin B1) that features a disulfide bond and a nitrate group. This compound is characterized by its role as a potential antioxidant and its involvement in various biochemical processes. Thiamine itself is essential for carbohydrate metabolism and plays a crucial role in nerve function. The disulfide linkage in Thiamine Disulfide Nitrate may enhance its stability and bioavailability compared to thiamine alone. The nitrate group can also impart unique reactivity and solubility properties, making it of interest in both pharmaceutical and nutritional applications. In terms of physical properties, it is typically a crystalline solid, and its solubility can vary depending on the solvent used. As with many thiamine derivatives, it may exhibit specific biological activities, including potential neuroprotective effects, although further research is often necessary to fully elucidate its mechanisms and applications.
Formula:C24H34N8O4S2.2HNO3
InChI:InChI=1S/C24H34N8O4S2.2HNO3/c1-15(31(13-35)11-19-9-27-17(3)29-23(19)25)21(5-7-33)37-38-22(6-8-34)16(2)32(14-36)12-20-10-28-18(4)30-24(20)26;2*2-1(3)4/h9-10,13-14,33-34H,5-8,11-12H2,1-4H3,(H2,25,27,29)(H2,26,28,30);2*(H,2,3,4)/b21-15+,22-16+;;
InChI key:MSVPLGIAUQGBIU-VIDIEQDGSA-N
SMILES:CC1=NC=C(C(=N1)N)CN(/C(=C(/SS/C(=C(/N(C=O)CC2=CN=C(N=C2N)C)\C)/CCO)\CCO)/C)C=O.[N+](=O)([O-])O.[N+](=O)([O-])O
Found 2 products.