CAS 109138-28-5
:2-(3-methoxyphenyl)propan-2-amine
Description:
2-(3-Methoxyphenyl)propan-2-amine, also known as methoxyphenamine, is an organic compound characterized by its amine functional group and a propan-2-amine backbone. This substance features a methoxy group (-OCH3) attached to a phenyl ring, which contributes to its aromatic properties. The presence of the branched propan-2-amine structure indicates that it is a secondary amine, which can influence its reactivity and interaction with biological systems. Methoxyphenamine is of interest in medicinal chemistry and pharmacology due to its potential psychoactive effects, as it may interact with neurotransmitter systems. Its solubility in organic solvents and moderate polarity make it suitable for various chemical reactions and applications. Safety data regarding its toxicity and environmental impact should be considered, as with any chemical substance. Overall, 2-(3-methoxyphenyl)propan-2-amine represents a compound with significant implications in research and potential therapeutic uses.
Formula:C10H15NO
InChI:InChI=1/C10H15NO/c1-10(2,11)8-5-4-6-9(7-8)12-3/h4-7H,11H2,1-3H3
SMILES:CC(C)(c1cccc(c1)OC)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α,α-Dimethyl-3-methoxybenzylamine hydrochloride
CAS:α,α-Dimethyl-3-methoxybenzylamine hydrochloridePurity:≥95%Molecular weight:201.69g/mol[1-(3-Methoxyphenyl)-1-methylethyl]amine hydrochloride
CAS:<p>[1-(3-Methoxyphenyl)-1-methylethyl]amine hydrochloride is an organic compound that can be used as a reagent and a building block. It has been shown to be a useful intermediate in the synthesis of various other compounds, such as pharmaceuticals. This chemical is also used in research, as it is versatile and can react with other compounds easily. [1-(3-Methoxyphenyl)-1-methylethyl]amine hydrochloride can be purchased at our store if you are interested in purchasing this product.</p>Formula:C10H15NO·HClPurity:Min. 95%Color and Shape:PowderMolecular weight:201.69 g/mol2-(3-Methoxyphenyl)propan-2-amine
CAS:Formula:C10H15NOPurity:95.0%Color and Shape:SolidMolecular weight:165.236


