CymitQuimica logo

CAS 109144-59-4

:

tert-butyl(dimethoxy)propan-2-ylsilane

Description:
Tert-butyl(dimethoxy)propan-2-ylsilane, with the CAS number 109144-59-4, is an organosilicon compound characterized by the presence of a tert-butyl group and two methoxy groups attached to a propan-2-ylsilane backbone. This compound typically exhibits properties associated with silanes, such as low volatility and reactivity, particularly in condensation reactions. The tert-butyl group contributes to steric hindrance, which can influence the reactivity and stability of the molecule. The methoxy groups enhance solubility in organic solvents and may participate in various chemical reactions, including nucleophilic substitutions. Tert-butyl(dimethoxy)propan-2-ylsilane is often utilized in organic synthesis and materials science, particularly in the preparation of silane-based compounds and as a coupling agent in polymer chemistry. Its unique structure allows for potential applications in surface modification and as a precursor in the synthesis of more complex silane derivatives. As with many organosilicon compounds, handling should be done with care, considering potential reactivity and safety protocols.
Formula:C9H22O2Si
InChI:InChI=1/C9H22O2Si/c1-8(2)12(10-6,11-7)9(3,4)5/h8H,1-7H3
SMILES:CC(C)[Si](C(C)(C)C)(OC)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.