CAS 1091606-67-5: (αS,βS)-β-(Diphenylphosphino)-α-phenylbenzeneethanamine

Description:The chemical substance known as "(αS,βS)-β-(Diphenylphosphino)-α-phenylbenzeneethanamine," with the CAS number 1091606-67-5, is a chiral ligand commonly used in asymmetric synthesis and catalysis. This compound features a diphenylphosphino group, which enhances its ability to coordinate with transition metals, making it valuable in various catalytic applications, particularly in the formation of carbon-carbon bonds. The presence of the phenyl groups contributes to its steric and electronic properties, influencing its reactivity and selectivity in chemical reactions. As a chiral ligand, it can facilitate the production of enantiomerically enriched products, which is crucial in the pharmaceutical industry. The specific stereochemistry indicated by the (αS,βS) configuration plays a significant role in determining the ligand's interaction with metal centers and substrates. Overall, this compound exemplifies the intersection of organophosphorus chemistry and asymmetric catalysis, showcasing its importance in modern synthetic methodologies.

Formula:C₂₆H₂₄NP

InChI:InChI=1S/C26H24NP/c27-25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,25-26H,27H2/t25-,26-/m0/s1

InChI key:InChIKey=MIPGTOGPLXZBQX-UIOOFZCWSA-N

SMILES:NC(C=1C=CC=CC1)C(C=2C=CC=CC2)P(C=3C=CC=CC3)C=4C=CC=CC4

Synonyms:
(αS,βS)-β-(Diphenylphosphino)-α-phenylbenzeneethanamine
Benzeneethanamine, β-(diphenylphosphino)-α-phenyl-, (αS,βS)-
(1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
(1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine, min. 97% REF: 08-15-7103CAS: 1091606-67-5	min. 97%	84.00 €~309.00 €	Wed 26 Feb 25
(1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine, 97% REF: AC-43409CAS: 1091606-67-5	97%	To inquire	Thu 27 Feb 25
(1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethanamine REF: IN-DA003BJ0CAS: 1091606-67-5	97%	To inquire	Mon 03 Mar 25
(1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine REF: 3D-RTB60667CAS: 1091606-67-5	Min. 95%	- - -	Discontinued product