CAS 109164-46-7
:1,4-Dihydro-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-propanoic acid
Description:
1,4-Dihydro-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-propanoic acid, with the CAS number 109164-46-7, is a heterocyclic compound that features a thieno[2,3-d]pyrimidine core structure. This compound is characterized by its unique bicyclic framework, which includes a thiophene ring fused to a pyrimidine ring, contributing to its potential biological activity. The presence of the 5,6-dimethyl substituents enhances its lipophilicity and may influence its interaction with biological targets. The carboxylic acid functional group at the propanoic acid moiety suggests that it may exhibit acidic properties, which can affect its solubility and reactivity in various environments. This compound may be of interest in medicinal chemistry due to its structural features that could lead to pharmacological applications. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electronic and steric effects of the substituents present in its structure.
Formula:C11H12N2O3S
InChI:InChI=1S/C11H12N2O3S/c1-5-6(2)17-11-9(5)10(16)12-7(13-11)3-4-8(14)15/h3-4H2,1-2H3,(H,14,15)(H,12,13,16)
InChI key:InChIKey=CQXGWYASXFNDEZ-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(CCC(O)=O)=N1)SC(C)=C2C
Synonyms:- Thieno[2,3-d]pyrimidine-2-propanoic acid, 1,4-dihydro-5,6-dimethyl-4-oxo-
- 1,4-Dihydro-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidine-2-propanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-{5,6-Dimethyl-4-oxo-1H,4H-thieno[2,3-d]pyrimidin-2-yl}propanoic acid
CAS:Controlled Product3-{5,6-Dimethyl-4-oxo-1H,4H-thieno[2,3-d]pyrimidin-2-yl}propanoic acid is an antibody that blocks the activity of ion channels and has a high purity. It is used in cell biology research and as a pharmacological research tool. 3DMPPA is a receptor antagonist and can be used to inhibit or activate the function of peptides or ligands. 3DMPPA binds to receptors on cells, blocking the binding of other compounds and preventing them from activating the receptor. This compound can also be used as an inhibitor or activator of ion channels. 3DMPPA has been shown to have antiinflammatory effects on animal models, which may be due to its inhibition of prostaglandin synthesis by inhibiting cyclooxygenase 1 (COX1) and cyclooxygenase 2 (COX2).Formula:C11H12N2O3SPurity:Min. 95%Molecular weight:252.29 g/mol
