CAS 109194-13-0

2-Benzofuranmethanamine, α-phenyl-, hydrochloride (1:1)

Description:

2-Benzofuranmethanamine, α-phenyl-, hydrochloride (1:1), with the CAS number 109194-13-0, is a chemical compound characterized by its unique structure that combines a benzofuran moiety with an amine functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which is indicative of its polar nature due to the presence of the amine and hydrochloride functionalities. The hydrochloride salt form enhances its stability and solubility, making it suitable for various applications, including pharmaceutical research. The presence of the benzofuran ring contributes to its potential biological activity, as benzofuran derivatives are often explored for their pharmacological properties. Additionally, the α-phenyl substitution may influence its interaction with biological targets, potentially affecting its efficacy and safety profile. As with many chemical substances, handling should be conducted with care, adhering to safety protocols to mitigate any risks associated with its use.

Formula: C₁₅H₁₃NO·ClH

InChI: InChI=1S/C15H13NO.ClH/c16-15(11-6-2-1-3-7-11)14-10-12-8-4-5-9-13(12)17-14;/h1-10,15H,16H2;1H

InChI key: InChIKey=NMEZLAOJMVUUEP-UHFFFAOYSA-N

SMILES: C(N)(C1=CC=2C(O1)=CC=CC2)C3=CC=CC=C3.Cl

Synonyms:

• 2-Benzofuranmethanamine, α-phenyl-, hydrochloride
• 2-Benzofuranmethanamine, α-phenyl-, hydrochloride (1:1)
• (1-Benzofuran-2-yl)(phenyl)methanamine hydrochloride

1-Benzofuran-2-yl(phenyl)methanamine hydrochloride

CAS: 109194-13-0

Versatile small molecule scaffold

Formula: C₁₅H₁₄ClNO

Purity: Min. 95%

Molecular weight: 259.73 g/mol

Ref: 3D-JEA19413