CymitQuimica logo

CAS 1092108-80-9

:

3-(2,4-Difluorophenyl)pyrrolidine

Description:
3-(2,4-Difluorophenyl)pyrrolidine is a chemical compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of a 2,4-difluorophenyl group attached to the pyrrolidine structure significantly influences its chemical properties and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The difluorophenyl substituent introduces electronegative fluorine atoms, which can enhance lipophilicity and potentially affect the compound's interaction with biological targets. As a result, 3-(2,4-Difluorophenyl)pyrrolidine may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its unique structure could contribute to specific pharmacological effects, making it a candidate for further research in drug discovery and development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C10H11F2N
InChI:InChI=1S/C10H11F2N/c11-8-1-2-9(10(12)5-8)7-3-4-13-6-7/h1-2,5,7,13H,3-4,6H2
InChI key:InChIKey=QSBSGFHTQBDWJV-UHFFFAOYSA-N
SMILES:FC1=C(C2CCNC2)C=CC(F)=C1
Synonyms:
  • Pyrrolidine, 3-(2,4-difluorophenyl)-
  • 3-(2,4-Difluorophenyl)pyrrolidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.