CAS 109216-60-6
:METHYL 1-METHYL-3-INDAZOLECARBOXYLATE
Description:
Methyl 1-methyl-3-indazolecarboxylate, identified by its CAS number 109216-60-6, is a chemical compound characterized by its indazole structure, which is a bicyclic compound containing a five-membered ring fused to a six-membered ring. This compound features a methyl group and a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. Typically, indazole derivatives exhibit a range of biological activities, making them of interest in medicinal chemistry. Methyl 1-methyl-3-indazolecarboxylate may be utilized as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its solubility and stability can vary based on the solvent and conditions used, which are important considerations for its practical applications. Additionally, the compound's molecular structure suggests potential for interactions with biological targets, warranting further investigation into its pharmacological properties. As with all chemical substances, proper handling and safety measures should be observed due to potential hazards associated with its use.
Formula:C10H10N2O2
InChI:InChI=1/C10H10N2O2/c1-12-8-6-4-3-5-7(8)9(11-12)10(13)14-2/h3-6H,1-2H3
SMILES:Cn1c2ccccc2c(C(=O)OC)n1
Synonyms:- Methyl-N-Methyl-Indazole-3-Carboxylate
- Methyl-N-Methyl-Indozole-3-Carboxylate
- Methyl 1-methylindozole-3-carboxylate
- 1H-Indazole-3-carboxylic acid, 1-methyl-, methylester
- methyl 1-methyl-1H-indazole-3-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 1-methyl-1H-indazole-3-carboxylate
CAS:Formula:C10H10N2O2Purity:97%Color and Shape:SolidMolecular weight:190.1986Methyl 1-methyl-1H-indazole-3-carboxylate
CAS:Methyl 1-methyl-1H-indazole-3-carboxylateFormula:C10H10N2O2Purity:≥95%Color and Shape:SolidMolecular weight:190.20g/molMethyl 1-Methyl-1h-indazole-3-carboxylate
CAS:Controlled ProductFormula:C10H10N2O2Color and Shape:NeatMolecular weight:190.2Methyl-d3 1-Methyl-d3-1H-indazole-3-carboxylate
CAS:Controlled Product<p>Methyl-d3 1-Methyl-d3-1H-indazole-3-carboxylate (MDI) is a reagent used in the synthesis of organic compounds. It is formed by the reaction of lithium aluminum hydride and methyl acetate, which produces a lithiated carboxylic acid. This compound can be reacted with amines to form amides or with thionyl chloride to form sulfonyl chlorides. The reactions are reversible, so it can be regenerated when needed.</p>Formula:C10H4D6N2O2Purity:Min. 95%Molecular weight:196.24 g/mol




