CAS 109221-96-7: (2-PHENOXY-PHENYL)-HYDRAZINE HYDROCHLORIDE
Description:(2-Phenoxy-phenyl)-hydrazine hydrochloride is a chemical compound characterized by its hydrazine functional group, which is linked to a phenoxy-phenyl moiety. This compound typically appears as a crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrazine and hydrochloride functionalities. It is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals or agrochemicals. The presence of the phenoxy group can impart specific reactivity and properties, making it useful in various chemical reactions, including coupling reactions and as a potential ligand in coordination chemistry. Safety precautions should be observed when handling this compound, as hydrazines are known to be toxic and potentially carcinogenic. Proper storage conditions, including protection from moisture and light, are essential to maintain its stability and integrity. As with any chemical, thorough understanding of its properties, reactivity, and safety data is crucial for effective and safe use in laboratory or industrial settings.
Formula:C12H13ClN2O
InChI:InChI=1S/C12H12N2O.ClH/c13-14-11-8-4-5-9-12(11)15-10-6-2-1-3-7-10;/h1-9,14H,13H2;1H
InChI key:InChIKey=DJVCMGYLUIMOTN-UHFFFAOYSA-N
SMILES:Cl.O(C=1C=CC=CC1)C=2C=CC=CC2NN
- Synonyms:
- 1-(2-Phenoxyphenyl)Hydrazine Hydrochloride
- Bio-Farma Bf000754
- Hydrazine, (2-phenoxyphenyl)-, hydrochloride (1:1)
- Hydrazine, (2-phenoxyphenyl)-, monohydrochloride
- Hydrazine, (o-phenoxyphenyl)-, hydrochloride
- N'-(2-Phenoxy-Phenyl)-Hydrazinium, Chloride
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | (2-PHENOXY-PHENYL)-HYDRAZINE HYDROCHLORIDE REF: IN-DA008RQHCAS: 109221-96-7 | - - - | To inquire | Tue 04 Mar 25 |
 | (2-Phenoxy-phenyl)-hydrazine HCl REF: 3D-JEA22196CAS: 109221-96-7 | Min. 95% | To inquire | Tue 15 Apr 25 |
 | (2-Phenoxyphenyl)hydrazine hydrochloride REF: 10-F635881CAS: 109221-96-7 | 95% | - - - | Discontinued product |
(2-PHENOXY-PHENYL)-HYDRAZINE HYDROCHLORIDE
Ref: IN-DA008RQH
| Undefined size | To inquire |
(2-Phenoxy-phenyl)-hydrazine HCl
Ref: 3D-JEA22196
| 250mg | 457.00 € | ||
| 2500mg | 1,440.00 € |
Ref: 10-F635881
| 1g | Discontinued | Request information | |
| 2.5g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
