CAS 1092286-06-0
:4-Bromo-3-methyl-1H-pyrrole-2-carboxylic acid
Description:
4-Bromo-3-methyl-1H-pyrrole-2-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a bromine atom at the 4-position and a methyl group at the 3-position contributes to its unique reactivity and properties. The carboxylic acid functional group at the 2-position enhances its acidity and solubility in polar solvents, making it useful in various chemical reactions, including synthesis and modification of other compounds. This compound may exhibit biological activity, potentially serving as a building block in pharmaceuticals or agrochemicals. Its molecular structure allows for various substitution reactions, which can be exploited in synthetic organic chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine and methyl substituents. Overall, 4-Bromo-3-methyl-1H-pyrrole-2-carboxylic acid is a versatile compound with applications in research and industry, particularly in the fields of medicinal chemistry and materials science.
Formula:C6H6BrNO2
InChI:InChI=1S/C6H6BrNO2/c1-3-4(7)2-8-5(3)6(9)10/h2,8H,1H3,(H,9,10)
InChI key:InChIKey=LIKZINJLVUQUOI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C(Br)=CN1
Synonyms:- 1H-Pyrrole-2-carboxylic acid, 4-bromo-3-methyl-
- 4-Bromo-3-methyl-1H-pyrrole-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
