CAS 1092286-38-8
:3-Chloro-N2-cyclopropyl-1,2-benzenediamine
Description:
3-Chloro-N2-cyclopropyl-1,2-benzenediamine is an organic compound characterized by its structure, which includes a chlorinated aromatic ring and a cyclopropyl group attached to a diamine framework. The presence of the chlorine atom introduces a halogen functionality, which can influence the compound's reactivity and solubility. The cyclopropyl group, known for its strain and unique reactivity, can impart distinctive chemical properties, making this compound of interest in medicinal chemistry and material science. The diamine structure suggests potential for forming various derivatives through reactions such as acylation or alkylation. Additionally, the compound may exhibit biological activity, which could be explored for pharmaceutical applications. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 3-Chloro-N2-cyclopropyl-1,2-benzenediamine represents a versatile scaffold for further chemical exploration and potential applications in various fields.
Formula:C9H11ClN2
InChI:InChI=1S/C9H11ClN2/c10-7-2-1-3-8(11)9(7)12-6-4-5-6/h1-3,6,12H,4-5,11H2
InChI key:InChIKey=GBKUNNPKDPXREU-UHFFFAOYSA-N
SMILES:N(C1=C(Cl)C=CC=C1N)C2CC2
Synonyms:- 3-Chloro-2-N-cyclopropylbenzene-1,2-diamine
- 3-Chloro-N2-cyclopropyl-1,2-benzenediamine
- 1,2-Benzenediamine, 3-chloro-N2-cyclopropyl-
- 3-Chloro-N2-cyclopropyl-1,2-Benzenediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
