CymitQuimica logo

CAS 1092287-21-2

:

4-Chloro-5-iodo-2-methylpyridine

Description:
4-Chloro-5-iodo-2-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with chlorine and iodine atoms, as well as a methyl group. The presence of these halogen substituents significantly influences its chemical reactivity and physical properties. Typically, compounds like this exhibit polar characteristics due to the electronegative halogens, which can enhance their solubility in polar solvents. The methyl group contributes to the overall hydrophobic nature of the molecule, affecting its interactions in various chemical environments. This compound may be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to its potential as a building block in more complex molecular architectures. Additionally, its unique substitution pattern can lead to interesting electronic properties, making it a subject of study in materials science and medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose health risks and environmental concerns.
Formula:C6H5ClIN
InChI:InChI=1S/C6H5ClIN/c1-4-2-5(7)6(8)3-9-4/h2-3H,1H3
InChI key:InChIKey=OMPQIXIZXUOZPM-UHFFFAOYSA-N
SMILES:ClC=1C(I)=CN=C(C)C1
Synonyms:
  • Pyridine, 4-chloro-5-iodo-2-methyl-
  • 4-Chloro-5-iodo-2-methylpyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.