CymitQuimica logo

CAS 1092287-30-3

:

2-Chloro-5-quinolinecarboxylic acid

Description:
2-Chloro-5-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a carboxylic acid functional group and a chlorine substituent at the 2-position of the quinoline ring, contributing to its reactivity and potential applications in various chemical reactions. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The chlorine atom can influence the compound's electronic properties, making it useful in medicinal chemistry and as a building block for synthesizing other complex molecules. Additionally, the presence of the quinoline moiety is often associated with biological activity, which may include antimicrobial or anti-inflammatory properties. Safety data should be consulted for handling, as with many chemical substances, due to potential hazards associated with its use.
Formula:C10H6ClNO2
InChI:InChI=1S/C10H6ClNO2/c11-9-5-4-6-7(10(13)14)2-1-3-8(6)12-9/h1-5H,(H,13,14)
InChI key:PIDMGSRYEKDYOU-UHFFFAOYSA-N
SMILES:c1cc(c2ccc(Cl)nc2c1)C(=O)O
Synonyms:
  • 2-Chloro-quinoline-5-carboxylic acid
  • 2-Chloroquinoline-5-carboxylic acid
Found 4 products.