CAS 1092297-71-6

5-Bromo-2-hydrazinylbenzothiazole

Description:

5-Bromo-2-hydrazinylbenzothiazole is a chemical compound characterized by its unique structural features, which include a benzothiazole ring substituted with a bromine atom and a hydrazine functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the hydrazine moiety. It is often studied for its applications in medicinal chemistry, particularly in the development of pharmaceuticals, as well as in agrochemical research. The presence of the bromine atom can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, benzothiazole derivatives are known for their diverse range of activities, including antimicrobial and anticancer properties. Safety and handling precautions should be observed due to the potential toxicity associated with hydrazine derivatives. Overall, 5-Bromo-2-hydrazinylbenzothiazole represents a significant compound in the field of organic chemistry with implications for further research and application in various scientific domains.

Formula: C₇H₆BrN₃S

InChI: InChI=1S/C7H6BrN3S/c8-4-1-2-6-5(3-4)10-7(11-9)12-6/h1-3H,9H2,(H,10,11)

InChI key: InChIKey=XWYWJZSAHKLAPH-UHFFFAOYSA-N

SMILES: N(N)=C1SC=2C(N1)=CC(Br)=CC2

Synonyms:

• (5-Bromo-benzothiazol-2-yl)-hydrazine
• 5-Bromo-2-hydrazinylbenzothiazole
• Benzothiazole, 5-bromo-2-hydrazinyl-