
CAS 1092304-71-6
:2-[[(3-Bromo-4-methoxyphenyl)methyl]amino]ethanol
Description:
2-[[(3-Bromo-4-methoxyphenyl)methyl]amino]ethanol, identified by its CAS number 1092304-71-6, is an organic compound characterized by its complex structure that includes a brominated aromatic ring, a methoxy group, and an ethanolamine moiety. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methoxy group enhances the compound's solubility in organic solvents and may influence its electronic properties, potentially affecting its biological activity. The amino group in the ethanolamine structure can participate in hydrogen bonding, which may enhance its interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic synthesis techniques, and its purity and identity can be confirmed through methods such as NMR spectroscopy and mass spectrometry. Overall, this compound's unique structural features suggest potential applications in drug development and other fields of chemistry.
Formula:C10H14BrNO2
InChI:InChI=1S/C10H14BrNO2/c1-14-10-3-2-8(6-9(10)11)7-12-4-5-13/h2-3,6,12-13H,4-5,7H2,1H3
InChI key:InChIKey=OAXRVBHHWBQRBX-UHFFFAOYSA-N
SMILES:C(NCCO)C1=CC(Br)=C(OC)C=C1
Synonyms:- 2-[[(3-Bromo-4-methoxyphenyl)methyl]amino]ethanol
- Ethanol, 2-[[(3-bromo-4-methoxyphenyl)methyl]amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.