
CAS 1092307-34-0
:3-Amino-5-chloro-4-methylbenzoic acid
Description:
3-Amino-5-chloro-4-methylbenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group, a chloro group, and a methyl group, along with a carboxylic acid functional group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid group. The amino group can participate in hydrogen bonding, enhancing its solubility in water. The chloro substituent introduces a degree of electronegativity, influencing the compound's reactivity and potential applications in organic synthesis. It may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. The presence of multiple functional groups allows for various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted, as with any chemical, to understand its handling and potential hazards. Overall, 3-Amino-5-chloro-4-methylbenzoic acid is a versatile compound with significant implications in chemical research and industry.
Formula:C8H8ClNO2
InChI:InChI=1S/C8H8ClNO2/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3H,10H2,1H3,(H,11,12)
InChI key:InChIKey=WAIOKGUYCTWISY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(Cl)=C(C)C(N)=C1
Synonyms:- Benzoic acid, 3-amino-5-chloro-4-methyl-
- 3-Amino-5-chloro-4-methylbenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.