CymitQuimica logo

CAS 109231-85-8

:

2-Propanol, 1,1′-[2-butyne-1,4-diylbis(oxy)]bis-, homopolymer

Description:
2-Propanol, 1,1′-[2-butyne-1,4-diylbis(oxy)]bis-, homopolymer, identified by CAS number 109231-85-8, is a synthetic polymer characterized by its structure, which includes repeating units derived from 2-propanol and a butyne-based linkage. This polymer exhibits properties typical of polyols, including good solubility in various organic solvents and potential for forming hydrogen bonds due to the presence of hydroxyl groups. Its molecular structure suggests it may possess a degree of flexibility and resilience, making it suitable for applications in coatings, adhesives, and sealants. The presence of butyne linkages can enhance its thermal stability and mechanical strength. Additionally, the polymer's hydrophilic nature, attributed to the hydroxyl groups, may influence its interaction with water and other polar solvents. Overall, this compound's unique characteristics stem from its specific molecular architecture, which can be tailored for various industrial applications, particularly in materials science and polymer chemistry.
Formula:(C10H18O4)x
InChI:InChI=1S/C10H18O4/c1-9(11)7-13-5-3-4-6-14-8-10(2)12/h9-12H,5-8H2,1-2H3
InChI key:InChIKey=JBTLOLAWFPERSC-UHFFFAOYSA-N
SMILES:O(CC(C)O)CC#CCOCC(C)O
Synonyms:
  • 2-Propanol, 1,1′-[2-butyne-1,4-diylbis(oxy)]bis-, homopolymer
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.