
CAS 109232-76-0
:Camellianin B
Description:
Camellianin B is a flavonoid compound primarily derived from plants in the Camellia genus, particularly noted for its presence in tea leaves. It exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. The compound is characterized by its polyphenolic structure, which contributes to its ability to scavenge free radicals and modulate various biochemical pathways. Camellianin B is soluble in organic solvents and has limited solubility in water, typical of many flavonoids. Its stability can be influenced by factors such as pH and light exposure, which may affect its efficacy in biological systems. Research into Camellianin B continues to explore its potential health benefits and mechanisms of action, particularly in the context of chronic diseases. Overall, this compound represents a significant area of interest within natural product chemistry and nutraceutical development.
Formula:C27H30O14
InChI:InChI=1S/C27H30O14/c1-10-20(32)21(33)23(35)26(37-10)41-25-18(9-28)40-27(24(36)22(25)34)39-17-7-13(30)6-16-19(17)14(31)8-15(38-16)11-2-4-12(29)5-3-11/h2-8,10,18,20-30,32-36H,9H2,1H3/t10-,18+,20-,21+,22+,23+,24+,25+,26-,27+/m0/s1
InChI key:InChIKey=LRFDUPNLCDXZOE-ZLDQKHMLSA-N
SMILES:O(C1=C2C(OC(=CC2=O)C3=CC=C(O)C=C3)=CC(O)=C1)[C@@H]4O[C@H](CO)[C@@H](O[C@H]5[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O5)[C@H](O)[C@H]4O
Synonyms:- 4H-1-Benzopyran-4-one, 5-[[4-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-7-hydroxy-2-(4-hydroxyphenyl)-
- 5-[[4-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-7-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
- Camellianin B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Camellianin B
CAS:Camellianin B analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C27H30O14Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:578.53Camellianin B
CAS:Camellianin B, a flavonoid from Camellianin A, has antioxidant effects and blocks ACE.Formula:C27H30O14Color and Shape:SolidMolecular weight:578.523Camellianin B
CAS:Camellianin B is a potent inhibitor of kinase activity that has been found in urine and is an analog of the natural product Camellianin A. This compound has been shown to induce apoptosis in Chinese hamster ovary cells and human leukemia cells, making it a promising candidate for medicinal use in cancer treatment. Camellianin B inhibits the cell cycle by targeting specific proteins involved in tumor growth, making it an effective inhibitor of cancer cell proliferation. Its potential as a therapeutic agent for cancer treatment is currently being investigated.Formula:C27H30O14Purity:Min. 95%Molecular weight:578.5 g/mol


