CAS 1092346-13-8

5-Methoxy-1-(2-pyrimidinyl)-1H-indole-3-methanol

Description:

5-Methoxy-1-(2-pyrimidinyl)-1H-indole-3-methanol, with the CAS number 1092346-13-8, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a methoxy group (-OCH3) and a pyrimidinyl substituent, which contribute to its unique chemical properties and potential biological activity. The presence of the hydroxymethyl group (-CH2OH) at the 3-position of the indole ring enhances its solubility and reactivity. Compounds of this type are often studied for their pharmacological properties, including potential roles in medicinal chemistry, particularly in the development of drugs targeting various biological pathways. The specific arrangement of functional groups can influence the compound's interactions with biological targets, making it a subject of interest in research related to neuropharmacology and other therapeutic areas. As with many indole derivatives, it may exhibit a range of activities, including anti-inflammatory, anti-cancer, or neuroprotective effects.

Formula: C₁₄H₁₃N₃O₂

InChI: InChI=1S/C14H13N3O2/c1-19-11-3-4-13-12(7-11)10(9-18)8-17(13)14-15-5-2-6-16-14/h2-8,18H,9H2,1H3

InChI key: InChIKey=BGMXNFVFQPEDPW-UHFFFAOYSA-N

SMILES: C(O)C=1C=2C(N(C1)C=3N=CC=CN3)=CC=C(OC)C2

Synonyms:

• 1H-Indole-3-methanol, 5-methoxy-1-(2-pyrimidinyl)-
• 5-Methoxy-1-(2-pyrimidinyl)-1H-indole-3-methanol